C13H21N3O3S — CID 136745640
2-ethyl-2-(methylamino)-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pentanoic acid (PubChem CID 136745640) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-ethyl-2-(methylamino)-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pentanoic acid.
| Compound Name | 2-ethyl-2-(methylamino)-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 136745640 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-ethyl-2-(methylamino)-5-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]pentanoic acid |
| SMILES | CCC(CCCSc1nc(C)cc(=O)[nH]1)(NC)C(=O)O |
| InChI | InChI=1S/C13H21N3O3S/c1-4-13(14-3,11(18)19)6-5-7-20-12-15-9(2)8-10(17)16-12/h8,14H,4-7H2,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | HDHAAXFNGXWZKV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|