C13H23N3O2S — CID 114000936
2-ethyl-5-(1H-imidazol-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoic acid (PubChem CID 114000936) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-ethyl-5-(1H-imidazol-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 2-ethyl-5-(1H-imidazol-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 114000936 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-ethyl-5-(1H-imidazol-2-ylsulfanyl)-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CCC(CCCSc1ncc[nH]1)(NC(C)C)C(=O)O |
| InChI | InChI=1S/C13H23N3O2S/c1-4-13(11(17)18,16-10(2)3)6-5-9-19-12-14-7-8-15-12/h7-8,10,16H,4-6,9H2,1-3H3,(H,14,15)(H,17,18) |
| InChIKey | VIMRMSCFMYFJNU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|