C15H23ClN2O2S — CID 106807586
5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 106807586) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 106807586 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-[(3-chloro-2-pyridinyl)sulfanyl]-2-ethyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CCC(CCCSc1ncccc1Cl)(NC(C)C)C(=O)O |
| InChI | InChI=1S/C15H23ClN2O2S/c1-4-15(14(19)20,18-11(2)3)8-6-10-21-13-12(16)7-5-9-17-13/h5,7,9,11,18H,4,6,8,10H2,1-3H3,(H,19,20) |
| InChIKey | JKAUDVVVHQAAHH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|