C15H23ClN2O2S — CID 64703569
methyl 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoate (PubChem CID 64703569) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is methyl 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoate.
| Compound Name | methyl 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 64703569 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoate |
| SMILES | COC(=O)C(C)(CC(C)Sc1ncccc1Cl)NC(C)C |
| InChI | InChI=1S/C15H23ClN2O2S/c1-10(2)18-15(4,14(19)20-5)9-11(3)21-13-12(16)7-6-8-17-13/h6-8,10-11,18H,9H2,1-5H3 |
| InChIKey | HBLIQAPVKWEVBR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |