C14H21ClN2O2S — CID 64705170
4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid (PubChem CID 64705170) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 64705170 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)NC(C)(CC(C)Sc1ccc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C14H21ClN2O2S/c1-9(2)17-14(4,13(18)19)7-10(3)20-12-6-5-11(15)8-16-12/h5-6,8-10,17H,7H2,1-4H3,(H,18,19) |
| InChIKey | BRNFFYRFGUNMAE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |