C12H17ClN2O2S — CID 64703368
4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(methylamino)pentanoic acid (PubChem CID 64703368) has the molecular formula C12H17ClN2O2S and a molecular weight of 288.80 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(methylamino)pentanoic acid.
| Compound Name | 4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 64703368 |
| Molecular Formula | C12H17ClN2O2S |
| Molecular Weight | 288.80 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(methylamino)pentanoic acid |
| SMILES | CNC(C)(CC(C)Sc1ccc(Cl)cn1)C(=O)O |
| InChI | InChI=1S/C12H17ClN2O2S/c1-8(6-12(2,14-3)11(16)17)18-10-5-4-9(13)7-15-10/h4-5,7-8,14H,6H2,1-3H3,(H,16,17) |
| InChIKey | FZDQOOVICSQYDN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |