C14H23ClN2OS — CID 64821326
4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol (PubChem CID 64821326) has the molecular formula C14H23ClN2OS and a molecular weight of 302.87 g/mol. Its IUPAC name is 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol.
| Compound Name | 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64821326 |
| Molecular Formula | C14H23ClN2OS |
| Molecular Weight | 302.87 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 4-[(3-chloro-2-pyridinyl)sulfanyl]-2-methyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(C)(CO)CC(C)Sc1ncccc1Cl |
| InChI | InChI=1S/C14H23ClN2OS/c1-4-7-17-14(3,10-18)9-11(2)19-13-12(15)6-5-8-16-13/h5-6,8,11,17-18H,4,7,9-10H2,1-3H3 |
| InChIKey | GAXFEQHJDARERY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |