C10H12ClN3O2S — CID 47154150
3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(methylcarbamoyl)propanamide (PubChem CID 47154150) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is 3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(methylcarbamoyl)propanamide.
| Compound Name | 3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 47154150 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 3-[(3-chloro-2-pyridinyl)sulfanyl]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)CCSc1ncccc1Cl |
| InChI | InChI=1S/C10H12ClN3O2S/c1-12-10(16)14-8(15)4-6-17-9-7(11)3-2-5-13-9/h2-3,5H,4,6H2,1H3,(H2,12,14,15,16) |
| InChIKey | JNORKQQAAIUAKL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |