C12H9Cl2N3OS — CID 51319436
N-(5-chloro-2-pyridinyl)-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide (PubChem CID 51319436) has the molecular formula C12H9Cl2N3OS and a molecular weight of 314.20 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 51319436 |
| Molecular Formula | C12H9Cl2N3OS |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[(3-chloro-2-pyridinyl)sulfanyl]acetamide |
| SMILES | O=C(CSc1ncccc1Cl)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H9Cl2N3OS/c13-8-3-4-10(16-6-8)17-11(18)7-19-12-9(14)2-1-5-15-12/h1-6H,7H2,(H,16,17,18) |
| InChIKey | HDYJPQIIRFZAGW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |