C20H15ClFN3O2S — CID 24601940
2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]-N-(4-fluorophenyl)benzamide (PubChem CID 24601940) has the molecular formula C20H15ClFN3O2S and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 24601940 |
| Molecular Formula | C20H15ClFN3O2S |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.06 |
| IUPAC Name | 2-[[2-[(3-chloro-2-pyridinyl)sulfanyl]acetyl]amino]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(CSc1ncccc1Cl)Nc1ccccc1C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C20H15ClFN3O2S/c21-16-5-3-11-23-20(16)28-12-18(26)25-17-6-2-1-4-15(17)19(27)24-14-9-7-13(22)8-10-14/h1-11H,12H2,(H,24,27)(H,25,26) |
| InChIKey | FUQYURNCWCHCGV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |