C14H11ClF2N2O3S2 — CID 24601997
2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 24601997) has the molecular formula C14H11ClF2N2O3S2 and a molecular weight of 392.84 g/mol. Its IUPAC name is 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24601997 |
| Molecular Formula | C14H11ClF2N2O3S2 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 2-[(3-chloro-2-pyridinyl)sulfanyl]-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | O=C(CSc1ncccc1Cl)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H11ClF2N2O3S2/c15-11-2-1-7-18-13(11)23-8-12(20)19-9-3-5-10(6-4-9)24(21,22)14(16)17/h1-7,14H,8H2,(H,19,20) |
| InChIKey | VNXNQJWECYOJFI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |