C15H12ClF2NO4S — CID 8503445
2-(4-chlorophenoxy)-N-[4-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 8503445) has the molecular formula C15H12ClF2NO4S and a molecular weight of 375.78 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[4-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8503445 |
| Molecular Formula | C15H12ClF2NO4S |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H12ClF2NO4S/c16-10-1-5-12(6-2-10)23-9-14(20)19-11-3-7-13(8-4-11)24(21,22)15(17)18/h1-8,15H,9H2,(H,19,20) |
| InChIKey | RHTYYKQHGOHELI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |