C21H15F2NO5S — CID 26898105
2-dibenzofuran-2-yloxy-N-[4-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 26898105) has the molecular formula C21H15F2NO5S and a molecular weight of 431.42 g/mol. Its IUPAC name is 2-dibenzofuran-2-yloxy-N-[4-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-dibenzofuran-2-yloxy-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 26898105 |
| Molecular Formula | C21H15F2NO5S |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 2-dibenzofuran-2-yloxy-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc2oc3ccccc3c2c1)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C21H15F2NO5S/c22-21(23)30(26,27)15-8-5-13(6-9-15)24-20(25)12-28-14-7-10-19-17(11-14)16-3-1-2-4-18(16)29-19/h1-11,21H,12H2,(H,24,25) |
| InChIKey | NMRPFUMXUCUKFS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |