C21H17NO5S — CID 9455805
2-dibenzofuran-2-yloxy-N-(4-methylsulfonylphenyl)acetamide (PubChem CID 9455805) has the molecular formula C21H17NO5S and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-dibenzofuran-2-yloxy-N-(4-methylsulfonylphenyl)acetamide.
| Compound Name | 2-dibenzofuran-2-yloxy-N-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 9455805 |
| Molecular Formula | C21H17NO5S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 2-dibenzofuran-2-yloxy-N-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)COc2ccc3oc4ccccc4c3c2)cc1 |
| InChI | InChI=1S/C21H17NO5S/c1-28(24,25)16-9-6-14(7-10-16)22-21(23)13-26-15-8-11-20-18(12-15)17-4-2-3-5-19(17)27-20/h2-12H,13H2,1H3,(H,22,23) |
| InChIKey | ZTHMNLXMINVCRD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |