C11H11F2NO6S — CID 60708142
2-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethoxy]acetic acid (PubChem CID 60708142) has the molecular formula C11H11F2NO6S and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 60708142 |
| Molecular Formula | C11H11F2NO6S |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[2-[4-(difluoromethylsulfonyl)anilino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C11H11F2NO6S/c12-11(13)21(18,19)8-3-1-7(2-4-8)14-9(15)5-20-6-10(16)17/h1-4,11H,5-6H2,(H,14,15)(H,16,17) |
| InChIKey | YGAVTZWZLLQXSK-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |