C15H12BrF2NO3S2 — CID 42041858
2-(2-bromophenyl)sulfanyl-N-[4-(difluoromethylsulfonyl)phenyl]acetamide (PubChem CID 42041858) has the molecular formula C15H12BrF2NO3S2 and a molecular weight of 436.30 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfanyl-N-[4-(difluoromethylsulfonyl)phenyl]acetamide.
| Compound Name | 2-(2-bromophenyl)sulfanyl-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 42041858 |
| Molecular Formula | C15H12BrF2NO3S2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 434.94 |
| IUPAC Name | 2-(2-bromophenyl)sulfanyl-N-[4-(difluoromethylsulfonyl)phenyl]acetamide |
| SMILES | O=C(CSc1ccccc1Br)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C15H12BrF2NO3S2/c16-12-3-1-2-4-13(12)23-9-14(20)19-10-5-7-11(8-6-10)24(21,22)15(17)18/h1-8,15H,9H2,(H,19,20) |
| InChIKey | WFZXWXOEPOAJAZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |