C19H17F2N3O3S2 — CID 24569165
N-[4-(difluoromethylsulfonyl)phenyl]-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide (PubChem CID 24569165) has the molecular formula C19H17F2N3O3S2 and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 24569165 |
| Molecular Formula | C19H17F2N3O3S2 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-(1-prop-2-enylbenzimidazol-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(S(=O)(=O)C(F)F)cc2)nc2ccccc21 |
| InChI | InChI=1S/C19H17F2N3O3S2/c1-2-11-24-16-6-4-3-5-15(16)23-19(24)28-12-17(25)22-13-7-9-14(10-8-13)29(26,27)18(20)21/h2-10,18H,1,11-12H2,(H,22,25) |
| InChIKey | XHGGBTAEUBWSCV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|