C18H15F2N3O4S3 — CID 24572439
N-[4-(difluoromethylsulfonyl)phenyl]-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide (PubChem CID 24572439) has the molecular formula C18H15F2N3O4S3 and a molecular weight of 471.53 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 24572439 |
| Molecular Formula | C18H15F2N3O4S3 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.02 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-2-(4-oxo-3-prop-2-enylthieno[3,2-d]pyrimidin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(S(=O)(=O)C(F)F)cc2)nc2ccsc2c1=O |
| InChI | InChI=1S/C18H15F2N3O4S3/c1-2-8-23-16(25)15-13(7-9-28-15)22-18(23)29-10-14(24)21-11-3-5-12(6-4-11)30(26,27)17(19)20/h2-7,9,17H,1,8,10H2,(H,21,24) |
| InChIKey | SZZRJLHNFUBPKJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|