C22H24N3O4S2- — CID 4177006
6-[2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]hexanoate (PubChem CID 4177006) has the molecular formula C22H24N3O4S2- and a molecular weight of 458.59 g/mol. Its IUPAC name is 6-[2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]hexanoate.
| Compound Name | 6-[2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 4177006 |
| Molecular Formula | C22H24N3O4S2- |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 6-[2-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]hexanoate |
| SMILES | CCc1ccc(NC(=O)CSc2nc3ccsc3c(=O)n2CCCCCC(=O)[O-])cc1 |
| InChI | InChI=1S/C22H25N3O4S2/c1-2-15-7-9-16(10-8-15)23-18(26)14-31-22-24-17-11-13-30-20(17)21(29)25(22)12-5-3-4-6-19(27)28/h7-11,13H,2-6,12,14H2,1H3,(H,23,26)(H,27,28)/p-1 |
| InChIKey | CENVJFMLWHFUNG-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|