C21H23N3O5S2 — CID 5068357
5-[2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]pentanoic acid (PubChem CID 5068357) has the molecular formula C21H23N3O5S2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 5-[2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]pentanoic acid.
| Compound Name | 5-[2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 5068357 |
| Molecular Formula | C21H23N3O5S2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 5-[2-[2-(4-ethoxyanilino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]pentanoic acid |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3ccsc3c(=O)n2CCCCC(=O)O)cc1 |
| InChI | InChI=1S/C21H23N3O5S2/c1-2-29-15-8-6-14(7-9-15)22-17(25)13-31-21-23-16-10-12-30-19(16)20(28)24(21)11-4-3-5-18(26)27/h6-10,12H,2-5,11,13H2,1H3,(H,22,25)(H,26,27) |
| InChIKey | DDOPYKKRDVQCDA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|