C28H29N3O5S2 — CID 5323225
benzyl 2-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxothieno[3,2-d]pyrimidin-2-yl]sulfanylacetate (PubChem CID 5323225) has the molecular formula C28H29N3O5S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is benzyl 2-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxothieno[3,2-d]pyrimidin-2-yl]sulfanylacetate.
| Compound Name | benzyl 2-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxothieno[3,2-d]pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 5323225 |
| Molecular Formula | C28H29N3O5S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | benzyl 2-[3-[6-(4-methoxyanilino)-6-oxohexyl]-4-oxothieno[3,2-d]pyrimidin-2-yl]sulfanylacetate |
| SMILES | COc1ccc(NC(=O)CCCCCn2c(SCC(=O)OCc3ccccc3)nc3ccsc3c2=O)cc1 |
| InChI | InChI=1S/C28H29N3O5S2/c1-35-22-13-11-21(12-14-22)29-24(32)10-6-3-7-16-31-27(34)26-23(15-17-37-26)30-28(31)38-19-25(33)36-18-20-8-4-2-5-9-20/h2,4-5,8-9,11-15,17H,3,6-7,10,16,18-19H2,1H3,(H,29,32) |
| InChIKey | MLJUDVOILYAJFN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|