C22H17N3O4S2 — CID 4180712
benzyl 2-(3-benzamido-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetate (PubChem CID 4180712) has the molecular formula C22H17N3O4S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is benzyl 2-(3-benzamido-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetate.
| Compound Name | benzyl 2-(3-benzamido-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 4180712 |
| Molecular Formula | C22H17N3O4S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | benzyl 2-(3-benzamido-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetate |
| SMILES | O=C(CSc1nc2ccsc2c(=O)n1NC(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C22H17N3O4S2/c26-18(29-13-15-7-3-1-4-8-15)14-31-22-23-17-11-12-30-19(17)21(28)25(22)24-20(27)16-9-5-2-6-10-16/h1-12H,13-14H2,(H,24,27) |
| InChIKey | NFUNKLZCHIMNOB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |