C24H19FN4O3S — CID 3580564
N-[2-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]-4-fluorobenzamide (PubChem CID 3580564) has the molecular formula C24H19FN4O3S and a molecular weight of 462.51 g/mol. Its IUPAC name is N-[2-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]-4-fluorobenzamide.
| Compound Name | N-[2-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3580564 |
| Molecular Formula | C24H19FN4O3S |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[2-[2-(benzylamino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]-4-fluorobenzamide |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1NC(=O)c1ccc(F)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C24H19FN4O3S/c25-18-12-10-17(11-13-18)22(31)28-29-23(32)19-8-4-5-9-20(19)27-24(29)33-15-21(30)26-14-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,26,30)(H,28,31) |
| InChIKey | CXTIJKHWANPRTO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |