C20H18N4O4S — CID 135714780
benzyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 135714780) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is benzyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | benzyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 135714780 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | benzyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | Nc1nc(SCC(=O)OCc2ccccc2)[nH]c(=O)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H18N4O4S/c21-17-16(22-18(26)14-9-5-2-6-10-14)19(27)24-20(23-17)29-12-15(25)28-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,22,26)(H3,21,23,24,27) |
| InChIKey | ZTGSSQXLNXNBEL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |