C15H16N4O5S — CID 135700789
methyl 2-[[4-amino-5-[(4-methoxybenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetate (PubChem CID 135700789) has the molecular formula C15H16N4O5S and a molecular weight of 364.38 g/mol. Its IUPAC name is methyl 2-[[4-amino-5-[(4-methoxybenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetate.
| Compound Name | methyl 2-[[4-amino-5-[(4-methoxybenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 135700789 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | methyl 2-[[4-amino-5-[(4-methoxybenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]acetate |
| SMILES | COC(=O)CSc1nc(N)c(NC(=O)c2ccc(OC)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N4O5S/c1-23-9-5-3-8(4-6-9)13(21)17-11-12(16)18-15(19-14(11)22)25-7-10(20)24-2/h3-6H,7H2,1-2H3,(H,17,21)(H3,16,18,19,22) |
| InChIKey | GJYISURMVKRAOL-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |