C15H18N4O3S — CID 135700754
N-(4-amino-6-oxo-2-propan-2-ylsulfanyl-1H-pyrimidin-5-yl)-4-methoxybenzamide (PubChem CID 135700754) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-(4-amino-6-oxo-2-propan-2-ylsulfanyl-1H-pyrimidin-5-yl)-4-methoxybenzamide.
| Compound Name | N-(4-amino-6-oxo-2-propan-2-ylsulfanyl-1H-pyrimidin-5-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 135700754 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(4-amino-6-oxo-2-propan-2-ylsulfanyl-1H-pyrimidin-5-yl)-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(N)nc(SC(C)C)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-8(2)23-15-18-12(16)11(14(21)19-15)17-13(20)9-4-6-10(22-3)7-5-9/h4-8H,1-3H3,(H,17,20)(H3,16,18,19,21) |
| InChIKey | GGYKBMRNVBPBFS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |