C19H17ClN4O2S — CID 135700932
N-[4-amino-6-oxo-2-[(1S)-1-phenylethyl]sulfanyl-1H-pyrimidin-5-yl]-4-chlorobenzamide (PubChem CID 135700932) has the molecular formula C19H17ClN4O2S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-[4-amino-6-oxo-2-[(1S)-1-phenylethyl]sulfanyl-1H-pyrimidin-5-yl]-4-chlorobenzamide.
| Compound Name | N-[4-amino-6-oxo-2-[(1S)-1-phenylethyl]sulfanyl-1H-pyrimidin-5-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 135700932 |
| Molecular Formula | C19H17ClN4O2S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | N-[4-amino-6-oxo-2-[(1S)-1-phenylethyl]sulfanyl-1H-pyrimidin-5-yl]-4-chlorobenzamide |
| SMILES | C[C@H](Sc1nc(N)c(NC(=O)c2ccc(Cl)cc2)c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClN4O2S/c1-11(12-5-3-2-4-6-12)27-19-23-16(21)15(18(26)24-19)22-17(25)13-7-9-14(20)10-8-13/h2-11H,1H3,(H,22,25)(H3,21,23,24,26)/t11-/m0/s1 |
| InChIKey | VGLUQXBXPVTZBY-NSHDSACASA-N |
| XLogP | 4.11 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |