C12H11ClN4O2S — CID 135700902
N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide (PubChem CID 135700902) has the molecular formula C12H11ClN4O2S and a molecular weight of 310.77 g/mol. Its IUPAC name is N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide.
| Compound Name | N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 135700902 |
| Molecular Formula | C12H11ClN4O2S |
| Molecular Weight | 310.77 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(4-amino-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)-4-chlorobenzamide |
| SMILES | CSc1nc(N)c(NC(=O)c2ccc(Cl)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H11ClN4O2S/c1-20-12-16-9(14)8(11(19)17-12)15-10(18)6-2-4-7(13)5-3-6/h2-5H,1H3,(H,15,18)(H3,14,16,17,19) |
| InChIKey | QLELPBKWTSUZMG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.77 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |