C14H13FN4O3S — CID 135700650
N-[4-amino-6-oxo-2-(2-oxopropylsulfanyl)-1H-pyrimidin-5-yl]-4-fluorobenzamide (PubChem CID 135700650) has the molecular formula C14H13FN4O3S and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[4-amino-6-oxo-2-(2-oxopropylsulfanyl)-1H-pyrimidin-5-yl]-4-fluorobenzamide.
| Compound Name | N-[4-amino-6-oxo-2-(2-oxopropylsulfanyl)-1H-pyrimidin-5-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 135700650 |
| Molecular Formula | C14H13FN4O3S |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-[4-amino-6-oxo-2-(2-oxopropylsulfanyl)-1H-pyrimidin-5-yl]-4-fluorobenzamide |
| SMILES | CC(=O)CSc1nc(N)c(NC(=O)c2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H13FN4O3S/c1-7(20)6-23-14-18-11(16)10(13(22)19-14)17-12(21)8-2-4-9(15)5-3-8/h2-5H,6H2,1H3,(H,17,21)(H3,16,18,19,22) |
| InChIKey | QSQLCRMHNVLQKU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |