C17H17FN4O5S — CID 135700649
ethyl 4-[[4-amino-5-[(4-fluorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-3-oxobutanoate (PubChem CID 135700649) has the molecular formula C17H17FN4O5S and a molecular weight of 408.41 g/mol. Its IUPAC name is ethyl 4-[[4-amino-5-[(4-fluorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 4-[[4-amino-5-[(4-fluorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 135700649 |
| Molecular Formula | C17H17FN4O5S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | ethyl 4-[[4-amino-5-[(4-fluorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nc(N)c(NC(=O)c2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H17FN4O5S/c1-2-27-12(24)7-11(23)8-28-17-21-14(19)13(16(26)22-17)20-15(25)9-3-5-10(18)6-4-9/h3-6H,2,7-8H2,1H3,(H,20,25)(H3,19,21,22,26) |
| InChIKey | VZWCYRRDSZXBTJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|