C15H16N4O4S — CID 135714770
ethyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 135714770) has the molecular formula C15H16N4O4S and a molecular weight of 348.38 g/mol. Its IUPAC name is ethyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | ethyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 135714770 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | ethyl 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc(N)c(NC(=O)c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N4O4S/c1-2-23-10(20)8-24-15-18-12(16)11(14(22)19-15)17-13(21)9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,17,21)(H3,16,18,19,22) |
| InChIKey | KYIVXZIPBJHRQG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |