C20H19N5O3S — CID 135714745
N-[4-amino-2-[2-(benzylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide (PubChem CID 135714745) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is N-[4-amino-2-[2-(benzylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide.
| Compound Name | N-[4-amino-2-[2-(benzylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 135714745 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[4-amino-2-[2-(benzylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide |
| SMILES | Nc1nc(SCC(=O)NCc2ccccc2)[nH]c(=O)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19N5O3S/c21-17-16(23-18(27)14-9-5-2-6-10-14)19(28)25-20(24-17)29-12-15(26)22-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,22,26)(H,23,27)(H3,21,24,25,28) |
| InChIKey | ZPCNSLZJGHYNSA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |