C17H21N5O4S — CID 135700816
N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]-4-methylbenzamide (PubChem CID 135700816) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]-4-methylbenzamide.
| Compound Name | N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 135700816 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-[4-amino-2-[2-(2-methoxyethylamino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]-4-methylbenzamide |
| SMILES | COCCNC(=O)CSc1nc(N)c(NC(=O)c2ccc(C)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H21N5O4S/c1-10-3-5-11(6-4-10)15(24)20-13-14(18)21-17(22-16(13)25)27-9-12(23)19-7-8-26-2/h3-6H,7-9H2,1-2H3,(H,19,23)(H,20,24)(H3,18,21,22,25) |
| InChIKey | USSXQEGYZPLGBH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|