C13H11N4O4S- — CID 135714784
2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate (PubChem CID 135714784) has the molecular formula C13H11N4O4S- and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate.
| Compound Name | 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 135714784 |
| Molecular Formula | C13H11N4O4S- |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-[(4-amino-5-benzamido-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetate |
| SMILES | Nc1nc(SCC(=O)[O-])[nH]c(=O)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H12N4O4S/c14-10-9(15-11(20)7-4-2-1-3-5-7)12(21)17-13(16-10)22-6-8(18)19/h1-5H,6H2,(H,15,20)(H,18,19)(H3,14,16,17,21)/p-1 |
| InChIKey | CMUZSPZFFOWFPS-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |