C19H17N5O3S — CID 135714738
N-[4-amino-2-(2-anilino-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide (PubChem CID 135714738) has the molecular formula C19H17N5O3S and a molecular weight of 395.44 g/mol. Its IUPAC name is N-[4-amino-2-(2-anilino-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide.
| Compound Name | N-[4-amino-2-(2-anilino-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 135714738 |
| Molecular Formula | C19H17N5O3S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[4-amino-2-(2-anilino-2-oxoethyl)sulfanyl-6-oxo-1H-pyrimidin-5-yl]benzamide |
| SMILES | Nc1nc(SCC(=O)Nc2ccccc2)[nH]c(=O)c1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17N5O3S/c20-16-15(22-17(26)12-7-3-1-4-8-12)18(27)24-19(23-16)28-11-14(25)21-13-9-5-2-6-10-13/h1-10H,11H2,(H,21,25)(H,22,26)(H3,20,23,24,27) |
| InChIKey | XUIZGLMSFICPBH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |