C20H15F3N4O3S — CID 135705908
N-(4-amino-6-oxo-2-phenacylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide (PubChem CID 135705908) has the molecular formula C20H15F3N4O3S and a molecular weight of 448.43 g/mol. Its IUPAC name is N-(4-amino-6-oxo-2-phenacylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(4-amino-6-oxo-2-phenacylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135705908 |
| Molecular Formula | C20H15F3N4O3S |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | N-(4-amino-6-oxo-2-phenacylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide |
| SMILES | Nc1nc(SCC(=O)c2ccccc2)[nH]c(=O)c1NC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F3N4O3S/c21-20(22,23)13-8-6-12(7-9-13)17(29)25-15-16(24)26-19(27-18(15)30)31-10-14(28)11-4-2-1-3-5-11/h1-9H,10H2,(H,25,29)(H3,24,26,27,30) |
| InChIKey | QBPNLIRRKSBUBK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |