C15H11F3N4O2S — CID 135701115
N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide (PubChem CID 135701115) has the molecular formula C15H11F3N4O2S and a molecular weight of 368.34 g/mol. Its IUPAC name is N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 135701115 |
| Molecular Formula | C15H11F3N4O2S |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-(trifluoromethyl)benzamide |
| SMILES | C#CCSc1nc(N)c(NC(=O)c2ccc(C(F)(F)F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H11F3N4O2S/c1-2-7-25-14-21-11(19)10(13(24)22-14)20-12(23)8-3-5-9(6-4-8)15(16,17)18/h1,3-6H,7H2,(H,20,23)(H3,19,21,22,24) |
| InChIKey | VJLOHQOZYQIXGO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|