C14H11ClN4O2S — CID 135700912
N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-chlorobenzamide (PubChem CID 135700912) has the molecular formula C14H11ClN4O2S and a molecular weight of 334.79 g/mol. Its IUPAC name is N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-chlorobenzamide.
| Compound Name | N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 135700912 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(4-amino-6-oxo-2-prop-2-ynylsulfanyl-1H-pyrimidin-5-yl)-4-chlorobenzamide |
| SMILES | C#CCSc1nc(N)c(NC(=O)c2ccc(Cl)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H11ClN4O2S/c1-2-7-22-14-18-11(16)10(13(21)19-14)17-12(20)8-3-5-9(15)6-4-8/h1,3-6H,7H2,(H,17,20)(H3,16,18,19,21) |
| InChIKey | YEFAIIVVZLVLQW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|