C17H18ClN4O4S- — CID 135700963
(2R)-2-[[4-amino-5-[(4-chlorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]hexanoate (PubChem CID 135700963) has the molecular formula C17H18ClN4O4S- and a molecular weight of 409.88 g/mol. Its IUPAC name is (2R)-2-[[4-amino-5-[(4-chlorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]hexanoate.
| Compound Name | (2R)-2-[[4-amino-5-[(4-chlorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]hexanoate |
|---|---|
| PubChem CID | 135700963 |
| Molecular Formula | C17H18ClN4O4S- |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (2R)-2-[[4-amino-5-[(4-chlorobenzoyl)amino]-6-oxo-1H-pyrimidin-2-yl]sulfanyl]hexanoate |
| SMILES | CCCC[C@@H](Sc1nc(N)c(NC(=O)c2ccc(Cl)cc2)c(=O)[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C17H19ClN4O4S/c1-2-3-4-11(16(25)26)27-17-21-13(19)12(15(24)22-17)20-14(23)9-5-7-10(18)8-6-9/h5-8,11H,2-4H2,1H3,(H,20,23)(H,25,26)(H3,19,21,22,24)/p-1/t11-/m1/s1 |
| InChIKey | TWVPIIPDXUVYON-LLVKDONJSA-M |
| XLogP | 1.66 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |