C13H13N4O5S- — CID 135831409
(2S)-2-[[4-amino-5-(furan-2-carbonylamino)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]butanoate (PubChem CID 135831409) has the molecular formula C13H13N4O5S- and a molecular weight of 337.34 g/mol. Its IUPAC name is (2S)-2-[[4-amino-5-(furan-2-carbonylamino)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]butanoate.
| Compound Name | (2S)-2-[[4-amino-5-(furan-2-carbonylamino)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]butanoate |
|---|---|
| PubChem CID | 135831409 |
| Molecular Formula | C13H13N4O5S- |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | (2S)-2-[[4-amino-5-(furan-2-carbonylamino)-6-oxo-1H-pyrimidin-2-yl]sulfanyl]butanoate |
| SMILES | CC[C@H](Sc1nc(N)c(NC(=O)c2ccco2)c(=O)[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C13H14N4O5S/c1-2-7(12(20)21)23-13-16-9(14)8(11(19)17-13)15-10(18)6-4-3-5-22-6/h3-5,7H,2H2,1H3,(H,15,18)(H,20,21)(H3,14,16,17,19)/p-1/t7-/m0/s1 |
| InChIKey | OXZZAFVXXKCGJQ-ZETCQYMHSA-M |
| XLogP | -0.18 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |