C14H14N4O5S — CID 135733501
N-[4-amino-2-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide (PubChem CID 135733501) has the molecular formula C14H14N4O5S and a molecular weight of 350.36 g/mol. Its IUPAC name is N-[4-amino-2-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide.
| Compound Name | N-[4-amino-2-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 135733501 |
| Molecular Formula | C14H14N4O5S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | N-[4-amino-2-[(Z)-2-hydroxy-4-oxopent-2-en-3-yl]sulfanyl-6-oxo-1H-pyrimidin-5-yl]furan-2-carboxamide |
| SMILES | CC(=O)/C(Sc1nc(N)c(NC(=O)c2ccco2)c(=O)[nH]1)=C(\C)O |
| InChI | InChI=1S/C14H14N4O5S/c1-6(19)10(7(2)20)24-14-17-11(15)9(13(22)18-14)16-12(21)8-4-3-5-23-8/h3-5,19H,1-2H3,(H,16,21)(H3,15,17,18,22)/b10-6- |
| InChIKey | USAYSERNWJKQEF-POHAHGRESA-N |
| XLogP | 1.67 |
| TPSA | 151.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|