C25H32N4O4S2 — CID 5323217
6-[2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(4-methoxyphenyl)hexanamide (PubChem CID 5323217) has the molecular formula C25H32N4O4S2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 6-[2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(4-methoxyphenyl)hexanamide.
| Compound Name | 6-[2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(4-methoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 5323217 |
| Molecular Formula | C25H32N4O4S2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 6-[2-[2-(butan-2-ylamino)-2-oxoethyl]sulfanyl-4-oxothieno[3,2-d]pyrimidin-3-yl]-N-(4-methoxyphenyl)hexanamide |
| SMILES | CCC(C)NC(=O)CSc1nc2ccsc2c(=O)n1CCCCCC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C25H32N4O4S2/c1-4-17(2)26-22(31)16-35-25-28-20-13-15-34-23(20)24(32)29(25)14-7-5-6-8-21(30)27-18-9-11-19(33-3)12-10-18/h9-13,15,17H,4-8,14,16H2,1-3H3,(H,26,31)(H,27,30) |
| InChIKey | QPXJQZGPOBGNMW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|