C18H22N3O4S2- — CID 4230103
6-[4-oxo-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylthieno[3,2-d]pyrimidin-3-yl]hexanoate (PubChem CID 4230103) has the molecular formula C18H22N3O4S2- and a molecular weight of 408.53 g/mol. Its IUPAC name is 6-[4-oxo-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylthieno[3,2-d]pyrimidin-3-yl]hexanoate.
| Compound Name | 6-[4-oxo-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylthieno[3,2-d]pyrimidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 4230103 |
| Molecular Formula | C18H22N3O4S2- |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 6-[4-oxo-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylthieno[3,2-d]pyrimidin-3-yl]hexanoate |
| SMILES | O=C([O-])CCCCCn1c(SCC(=O)N2CCCC2)nc2ccsc2c1=O |
| InChI | InChI=1S/C18H23N3O4S2/c22-14(20-8-4-5-9-20)12-27-18-19-13-7-11-26-16(13)17(25)21(18)10-3-1-2-6-15(23)24/h7,11H,1-6,8-10,12H2,(H,23,24)/p-1 |
| InChIKey | WCFHFSJQPRHUQE-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|