C17H15BrN2O3S3 — CID 24578384
2-[2-(4-bromophenyl)sulfonylethylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 24578384) has the molecular formula C17H15BrN2O3S3 and a molecular weight of 471.42 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfonylethylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[2-(4-bromophenyl)sulfonylethylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24578384 |
| Molecular Formula | C17H15BrN2O3S3 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 469.94 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfonylethylsulfanyl]-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCCS(=O)(=O)c2ccc(Br)cc2)nc2ccsc2c1=O |
| InChI | InChI=1S/C17H15BrN2O3S3/c1-2-8-20-16(21)15-14(7-9-24-15)19-17(20)25-10-11-26(22,23)13-5-3-12(18)4-6-13/h2-7,9H,1,8,10-11H2 |
| InChIKey | SCJUZKZXFFXDJV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|