C17H17N3O2S2 — CID 24622988
2-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 24622988) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24622988 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)[nH]c2C)nc2ccsc2c1=O |
| InChI | InChI=1S/C17H17N3O2S2/c1-4-6-20-16(22)15-13(5-7-23-15)19-17(20)24-9-14(21)12-8-10(2)18-11(12)3/h4-5,7-8,18H,1,6,9H2,2-3H3 |
| InChIKey | XCOQKPAFEUSTEY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|