C19H16F2N2O3S2 — CID 24558940
2-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 24558940) has the molecular formula C19H16F2N2O3S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24558940 |
| Molecular Formula | C19H16F2N2O3S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cc(C)ccc2OC(F)F)nc2ccsc2c1=O |
| InChI | InChI=1S/C19H16F2N2O3S2/c1-3-7-23-17(25)16-13(6-8-27-16)22-19(23)28-10-14(24)12-9-11(2)4-5-15(12)26-18(20)21/h3-6,8-9,18H,1,7,10H2,2H3 |
| InChIKey | RQJDJOLTIPHZEA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|