C21H19N3O3S2 — CID 24558999
2-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 24558999) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24558999 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 2-[2-oxo-2-[3-(2-oxopyrrolidin-1-yl)phenyl]ethyl]sulfanyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SCC(=O)c2cccc(N3CCCC3=O)c2)nc2ccsc2c1=O |
| InChI | InChI=1S/C21H19N3O3S2/c1-2-9-24-20(27)19-16(8-11-28-19)22-21(24)29-13-17(25)14-5-3-6-15(12-14)23-10-4-7-18(23)26/h2-3,5-6,8,11-12H,1,4,7,9-10,13H2 |
| InChIKey | MUSATKYZQCPKHN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|