C21H16F3N3O2S — CID 24500326
1-[3-[2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetyl]phenyl]pyrrolidin-2-one (PubChem CID 24500326) has the molecular formula C21H16F3N3O2S and a molecular weight of 431.44 g/mol. Its IUPAC name is 1-[3-[2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetyl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetyl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 24500326 |
| Molecular Formula | C21H16F3N3O2S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 1-[3-[2-[2-(trifluoromethyl)quinazolin-4-yl]sulfanylacetyl]phenyl]pyrrolidin-2-one |
| SMILES | O=C(CSc1nc(C(F)(F)F)nc2ccccc12)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C21H16F3N3O2S/c22-21(23,24)20-25-16-8-2-1-7-15(16)19(26-20)30-12-17(28)13-5-3-6-14(11-13)27-10-4-9-18(27)29/h1-3,5-8,11H,4,9-10,12H2 |
| InChIKey | KBQOSTMUGJHMJT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |