C29H27F3N4O2 — CID 170252020
N-[(1R,3S)-3-ethynyl-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 170252020) has the molecular formula C29H27F3N4O2 and a molecular weight of 520.56 g/mol. Its IUPAC name is N-[(1R,3S)-3-ethynyl-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(1R,3S)-3-ethynyl-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 170252020 |
| Molecular Formula | C29H27F3N4O2 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-[(1R,3S)-3-ethynyl-3-[[2-(trifluoromethyl)quinolin-4-yl]amino]cyclohexyl]-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | C#C[C@]1(Nc2cc(C(F)(F)F)nc3ccccc23)CCC[C@@H](NC(=O)c2cccc(N3CCCC3=O)c2)C1 |
| InChI | InChI=1S/C29H27F3N4O2/c1-2-28(35-24-17-25(29(30,31)32)34-23-12-4-3-11-22(23)24)14-6-9-20(18-28)33-27(38)19-8-5-10-21(16-19)36-15-7-13-26(36)37/h1,3-5,8,10-12,16-17,20H,6-7,9,13-15,18H2,(H,33,38)(H,34,35)/t20-,28+/m1/s1 |
| InChIKey | BIFDXECASOLWSM-NGOKVRLYSA-N |
| XLogP | 5.54 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|