C18H24N2O2 — CID 4063191
N-(2-methylcyclohexyl)-3-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 4063191) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-3-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-(2-methylcyclohexyl)-3-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 4063191 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-(2-methylcyclohexyl)-3-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CC1CCCCC1NC(=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C18H24N2O2/c1-13-6-2-3-9-16(13)19-18(22)14-7-4-8-15(12-14)20-11-5-10-17(20)21/h4,7-8,12-13,16H,2-3,5-6,9-11H2,1H3,(H,19,22) |
| InChIKey | UDZYQBZLJPOJIT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |